About prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate
prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate (PubChem CID 143612063) has the molecular formula C22H25N7O2
and a molecular weight of 419.49 g/mol. Its IUPAC name is prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate |
| PubChem CID | 143612063 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate |
| SMILES | C=CCOC(=O)C1CNCCN1c1ccc(-c2ccc3nc(N)nc(NN)c3c2)cc1 |
| InChI | InChI=1S/C22H25N7O2/c1-2-11-31-21(30)19-13-25-9-10-29(19)16-6-3-14(4-7-16)15-5-8-18-17(12-15)20(28-24)27-22(23)26-18/h2-8,12,19,25H,1,9-11,13,24H2,(H3,23,26,27,28) |
| InChIKey | QANVRPZZJNCOFK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate?
The IUPAC name of prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate (CID 143612063) is prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate.
What is the SMILES notation for prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate?
The canonical SMILES for prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate is C=CCOC(=O)C1CNCCN1c1ccc(-c2ccc3nc(N)nc(NN)c3c2)cc1.
What is the InChIKey of prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate?
The InChIKey is QANVRPZZJNCOFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N7O2/c1-2-11-31-21(30)19-13-25-9-10-29(19)16-6-3-14(4-7-16)15-5-8-18-17(12-15)20(28-24)27-22(23)26-18/h2-8,12,19,25H,1,9-11,13,24H2,(H3,23,26,27,28).
What are the key properties of prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate?
prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate has a molecular weight of 419.49 g/mol, XLogP of 1.67, 6 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 1-[4-(2-amino-4-hydrazinylquinazolin-6-yl)phenyl]piperazine-2-carboxylate is sourced from PubChem (CID 143612063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).