C11H14N2O — CID 143612175
2-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carbaldehyde (PubChem CID 143612175) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carbaldehyde.
| Compound Name | 2-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carbaldehyde |
|---|---|
| PubChem CID | 143612175 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carbaldehyde |
| SMILES | Cc1ccc2c(n1)CCN(C=O)CC2 |
| InChI | InChI=1S/C11H14N2O/c1-9-2-3-10-4-6-13(8-14)7-5-11(10)12-9/h2-3,8H,4-7H2,1H3 |
| InChIKey | HIUKCUZEEHGNJK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|