C15H28O — CID 143612345
1,4-dimethylcyclohexene;2,5-dimethyloxane (PubChem CID 143612345) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 1,4-dimethylcyclohexene;2,5-dimethyloxane.
| Compound Name | 1,4-dimethylcyclohexene;2,5-dimethyloxane |
|---|---|
| PubChem CID | 143612345 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 1,4-dimethylcyclohexene;2,5-dimethyloxane |
| SMILES | CC1=CCC(C)CC1.CC1CCC(C)OC1 |
| InChI | InChI=1S/C8H14.C7H14O/c1-7-3-5-8(2)6-4-7;1-6-3-4-7(2)8-5-6/h3,8H,4-6H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | BFBPGHBCXXEOLW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|