About 1,4-dimethylcyclohexene;2,5-dimethyloxane
1,4-dimethylcyclohexene;2,5-dimethyloxane (PubChem CID 143612345) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is 1,4-dimethylcyclohexene;2,5-dimethyloxane.
Molecular Properties
| Compound Name | 1,4-dimethylcyclohexene;2,5-dimethyloxane |
| PubChem CID | 143612345 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 1,4-dimethylcyclohexene;2,5-dimethyloxane |
| SMILES | CC1=CCC(C)CC1.CC1CCC(C)OC1 |
| InChI | InChI=1S/C8H14.C7H14O/c1-7-3-5-8(2)6-4-7;1-6-3-4-7(2)8-5-6/h3,8H,4-6H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | BFBPGHBCXXEOLW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethylcyclohexene;2,5-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylcyclohexene;2,5-dimethyloxane?
The IUPAC name of 1,4-dimethylcyclohexene;2,5-dimethyloxane (CID 143612345) is 1,4-dimethylcyclohexene;2,5-dimethyloxane.
What is the SMILES notation for 1,4-dimethylcyclohexene;2,5-dimethyloxane?
The canonical SMILES for 1,4-dimethylcyclohexene;2,5-dimethyloxane is CC1=CCC(C)CC1.CC1CCC(C)OC1.
What is the InChIKey of 1,4-dimethylcyclohexene;2,5-dimethyloxane?
The InChIKey is BFBPGHBCXXEOLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14.C7H14O/c1-7-3-5-8(2)6-4-7;1-6-3-4-7(2)8-5-6/h3,8H,4-6H2,1-2H3;6-7H,3-5H2,1-2H3.
What are the key properties of 1,4-dimethylcyclohexene;2,5-dimethyloxane?
1,4-dimethylcyclohexene;2,5-dimethyloxane has a molecular weight of 224.39 g/mol, XLogP of 4.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylcyclohexene;2,5-dimethyloxane is sourced from PubChem (CID 143612345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).