About propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate
propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate (PubChem CID 143612384) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate |
| PubChem CID | 143612384 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate |
| SMILES | CCC1CC(N)C[C@@H](CC)N1C(=O)OC(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-5-11-7-10(14)8-12(6-2)15(11)13(16)17-9(3)4/h9-12H,5-8,14H2,1-4H3/t10?,11-,12?/m1/s1 |
| InChIKey | LZZHZXFMUCWLRL-MOENNCHZSA-N |
| XLogP | 2.51 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate?
The IUPAC name of propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate (CID 143612384) is propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate.
What is the SMILES notation for propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate?
The canonical SMILES for propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate is CCC1CC(N)C[C@@H](CC)N1C(=O)OC(C)C.
What is the InChIKey of propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate?
The InChIKey is LZZHZXFMUCWLRL-MOENNCHZSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-5-11-7-10(14)8-12(6-2)15(11)13(16)17-9(3)4/h9-12H,5-8,14H2,1-4H3/t10?,11-,12?/m1/s1.
What are the key properties of propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate?
propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate has a molecular weight of 242.36 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2R)-4-amino-2,6-diethylpiperidine-1-carboxylate is sourced from PubChem (CID 143612384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).