C49H56ClF3N6O2 — CID 143612448
N-[[3-chloro-5-(trifluoromethyl)phenyl]methyl]-N-[(2R,6S)-2,6-diethylpiperidin-4-yl]-5-(1-tritylimidazol-4-yl)pyrimidin-2-amine;ethane;propan-2-yl formate (PubChem CID 143612448) has the molecular formula C49H56ClF3N6O2 and a molecular weight of 853.47 g/mol. Its IUPAC name is N-[[3-chloro-5-(trifluoromethyl)phenyl]methyl]-N-[(2R,6S)-2,6-diethylpiperidin-4-yl]-5-(1-tritylimidazol-4-yl)pyrimidin-2-amine;ethane;propan-2-yl formate.
| Compound Name | N-[[3-chloro-5-(trifluoromethyl)phenyl]methyl]-N-[(2R,6S)-2,6-diethylpiperidin-4-yl]-5-(1-tritylimidazol-4-yl)pyrimidin-2-amine;ethane;propan-2-yl formate |
|---|---|
| PubChem CID | 143612448 |
| Molecular Formula | C49H56ClF3N6O2 |
| Molecular Weight | 853.47 g/mol |
| Exact Mass | 852.41 |
| IUPAC Name | N-[[3-chloro-5-(trifluoromethyl)phenyl]methyl]-N-[(2R,6S)-2,6-diethylpiperidin-4-yl]-5-(1-tritylimidazol-4-yl)pyrimidin-2-amine;ethane;propan-2-yl formate |
| SMILES | CC.CC(C)OC=O.CC[C@@H]1CC(N(Cc2cc(Cl)cc(C(F)(F)F)c2)c2ncc(-c3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)cn2)C[C@H](CC)N1 |
| InChI | InChI=1S/C43H42ClF3N6.C4H8O2.C2H6/c1-3-37-23-39(24-38(4-2)51-37)53(27-30-20-35(43(45,46)47)22-36(44)21-30)41-48-25-31(26-49-41)40-28-52(29-50-40)42(32-14-8-5-9-15-32,33-16-10-6-11-17-33)34-18-12-7-13-19-34;1-4(2)6-3-5;1-2/h5-22,25-26,28-29,37-39,51H,3-4,23-24,27H2,1-2H3;3-4H,1-2H3;1-2H3/t37-,38+,39?;; |
| InChIKey | KFPQWMXKMIKTBS-ZBVFTJLBSA-N |
| XLogP | 11.76 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.47 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|