C40H46F6N4O3 — CID 143612485
tert-butyl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(5-phenylmethoxypyrimidin-2-yl)amino]-2-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-6-ethylpiperidine-1-carboxylate (PubChem CID 143612485) has the molecular formula C40H46F6N4O3 and a molecular weight of 744.82 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(5-phenylmethoxypyrimidin-2-yl)amino]-2-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-6-ethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(5-phenylmethoxypyrimidin-2-yl)amino]-2-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-6-ethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 143612485 |
| Molecular Formula | C40H46F6N4O3 |
| Molecular Weight | 744.82 g/mol |
| Exact Mass | 744.35 |
| IUPAC Name | tert-butyl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(5-phenylmethoxypyrimidin-2-yl)amino]-2-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-6-ethylpiperidine-1-carboxylate |
| SMILES | C=C/C(=C\C=C/C)C[C@H]1C[C@@H](N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ncc(OCc3ccccc3)cn2)CC(CC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H46F6N4O3/c1-7-10-14-27(8-2)19-34-22-33(21-32(9-3)50(34)37(51)53-38(4,5)6)49(25-29-17-30(39(41,42)43)20-31(18-29)40(44,45)46)36-47-23-35(24-48-36)52-26-28-15-12-11-13-16-28/h7-8,10-18,20,23-24,32-34H,2,9,19,21-22,25-26H2,1,3-6H3/b10-7-,27-14+/t32?,33-,34-/m0/s1 |
| InChIKey | QQZNLEAHWRXQDX-RANMBFJNSA-N |
| XLogP | 10.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.82 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|