About N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane
N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane (PubChem CID 143612813) has the molecular formula C10H12F5NO4S3
and a molecular weight of 401.40 g/mol. Its IUPAC name is N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane.
Molecular Properties
| Compound Name | N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane |
| PubChem CID | 143612813 |
| Molecular Formula | C10H12F5NO4S3 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane |
| SMILES | CC.O=S(=O)(NS(=O)(=O)C(F)(F)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C8H6F5NO4S3.C2H6/c9-7(10,11)20(15,16)14-21(17,18)8(12,13)19-6-4-2-1-3-5-6;1-2/h1-5,14H;1-2H3 |
| InChIKey | RTBNUPHYDUPPDQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane?
The IUPAC name of N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane (CID 143612813) is N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane.
What is the SMILES notation for N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane?
The canonical SMILES for N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane is CC.O=S(=O)(NS(=O)(=O)C(F)(F)Sc1ccccc1)C(F)(F)F.
What is the InChIKey of N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane?
The InChIKey is RTBNUPHYDUPPDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F5NO4S3.C2H6/c9-7(10,11)20(15,16)14-21(17,18)8(12,13)19-6-4-2-1-3-5-6;1-2/h1-5,14H;1-2H3.
What are the key properties of N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane?
N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane has a molecular weight of 401.40 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[difluoro(phenylsulfanyl)methyl]sulfonyl-1,1,1-trifluoromethanesulfonamide;ethane is sourced from PubChem (CID 143612813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).