About 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene
3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene (PubChem CID 143613082) has the molecular formula C10H13FO
and a molecular weight of 168.21 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene |
| PubChem CID | 143613082 |
| Molecular Formula | C10H13FO |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene |
| SMILES | CCC1=CC(F)=CCC=C1OC |
| InChI | InChI=1S/C10H13FO/c1-3-8-7-9(11)5-4-6-10(8)12-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | BHYWBXYSOWTGBG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene?
The IUPAC name of 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene (CID 143613082) is 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene.
What is the SMILES notation for 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene?
The canonical SMILES for 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene is CCC1=CC(F)=CCC=C1OC.
What is the InChIKey of 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene?
The InChIKey is BHYWBXYSOWTGBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO/c1-3-8-7-9(11)5-4-6-10(8)12-2/h5-7H,3-4H2,1-2H3.
What are the key properties of 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene?
3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene has a molecular weight of 168.21 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-fluoro-2-methoxycyclohepta-1,3,5-triene is sourced from PubChem (CID 143613082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).