C54H45N3 — CID 143613350
N-[4-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]phenyl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-(4-phenylphenyl)carbazol-3-amine (PubChem CID 143613350) has the molecular formula C54H45N3 and a molecular weight of 735.98 g/mol. Its IUPAC name is N-[4-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]phenyl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-(4-phenylphenyl)carbazol-3-amine.
| Compound Name | N-[4-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]phenyl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-(4-phenylphenyl)carbazol-3-amine |
|---|---|
| PubChem CID | 143613350 |
| Molecular Formula | C54H45N3 |
| Molecular Weight | 735.98 g/mol |
| Exact Mass | 735.36 |
| IUPAC Name | N-[4-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]phenyl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-(4-phenylphenyl)carbazol-3-amine |
| SMILES | C/C=C\C(=C/C)N(c1ccc(-c2ccc(N(C3=CCCC=C3)c3ccccc3)cc2)cc1)c1ccc2c(c1)c1ccccc1n2-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C54H45N3/c1-3-16-44(4-2)55(47-31-25-42(26-32-47)43-27-33-48(34-28-43)56(45-19-10-6-11-20-45)46-21-12-7-13-22-46)50-37-38-54-52(39-50)51-23-14-15-24-53(51)57(54)49-35-29-41(30-36-49)40-17-8-5-9-18-40/h3-6,8-12,14-39H,7,13H2,1-2H3/b16-3-,44-4+ |
| InChIKey | HCMGTMBFIMMWMX-SHTASABOSA-N |
| XLogP | 15.11 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.98 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|