C22H27N — CID 143613407
N-[(3E,5Z,8E)-7-methylidene-8-[(Z)-prop-1-enyl]dodeca-3,5,8,11-tetraen-4-yl]aniline (PubChem CID 143613407) has the molecular formula C22H27N and a molecular weight of 305.47 g/mol. Its IUPAC name is N-[(3E,5Z,8E)-7-methylidene-8-[(Z)-prop-1-enyl]dodeca-3,5,8,11-tetraen-4-yl]aniline.
| Compound Name | N-[(3E,5Z,8E)-7-methylidene-8-[(Z)-prop-1-enyl]dodeca-3,5,8,11-tetraen-4-yl]aniline |
|---|---|
| PubChem CID | 143613407 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-[(3E,5Z,8E)-7-methylidene-8-[(Z)-prop-1-enyl]dodeca-3,5,8,11-tetraen-4-yl]aniline |
| SMILES | C=CC/C=C(\C=C/C)C(=C)/C=C\C(=C/CC)Nc1ccccc1 |
| InChI | InChI=1S/C22H27N/c1-5-8-14-20(12-6-2)19(4)17-18-21(13-7-3)23-22-15-10-9-11-16-22/h5-6,9-18,23H,1,4,7-8H2,2-3H3/b12-6-,18-17-,20-14+,21-13+ |
| InChIKey | YOGUWVVCZWXSNO-KQGROETCSA-N |
| XLogP | 6.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|