About (3E)-5-iminopenta-1,3-dien-3-amine
(3E)-5-iminopenta-1,3-dien-3-amine (PubChem CID 143613476) has the molecular formula C5H8N2
and a molecular weight of 96.13 g/mol. Its IUPAC name is (3E)-5-iminopenta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | (3E)-5-iminopenta-1,3-dien-3-amine |
| PubChem CID | 143613476 |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | (3E)-5-iminopenta-1,3-dien-3-amine |
| SMILES | [H]/N=C/C=C(/N)C=C |
| InChI | InChI=1S/C5H8N2/c1-2-5(7)3-4-6/h2-4,6H,1,7H2/b5-3+,6-4+ |
| InChIKey | UWWQASNVTVPHKN-GGWOSOGESA-N |
| XLogP | 0.66 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-iminopenta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-iminopenta-1,3-dien-3-amine?
The IUPAC name of (3E)-5-iminopenta-1,3-dien-3-amine (CID 143613476) is (3E)-5-iminopenta-1,3-dien-3-amine.
What is the SMILES notation for (3E)-5-iminopenta-1,3-dien-3-amine?
The canonical SMILES for (3E)-5-iminopenta-1,3-dien-3-amine is [H]/N=C/C=C(/N)C=C.
What is the InChIKey of (3E)-5-iminopenta-1,3-dien-3-amine?
The InChIKey is UWWQASNVTVPHKN-GGWOSOGESA-N. The full InChI is InChI=1S/C5H8N2/c1-2-5(7)3-4-6/h2-4,6H,1,7H2/b5-3+,6-4+.
What are the key properties of (3E)-5-iminopenta-1,3-dien-3-amine?
(3E)-5-iminopenta-1,3-dien-3-amine has a molecular weight of 96.13 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-iminopenta-1,3-dien-3-amine is sourced from PubChem (CID 143613476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).