C24H31N3 — CID 143613622
3-(2-cyclohexa-1,5-dien-1-ylpropan-2-yl)-2,4,5-trimethylaniline;7,8-diazabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 143613622) has the molecular formula C24H31N3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 3-(2-cyclohexa-1,5-dien-1-ylpropan-2-yl)-2,4,5-trimethylaniline;7,8-diazabicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 3-(2-cyclohexa-1,5-dien-1-ylpropan-2-yl)-2,4,5-trimethylaniline;7,8-diazabicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 143613622 |
| Molecular Formula | C24H31N3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 3-(2-cyclohexa-1,5-dien-1-ylpropan-2-yl)-2,4,5-trimethylaniline;7,8-diazabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | Cc1cc(N)c(C)c(C(C)(C)C2=CCCC=C2)c1C.c1ccc2[nH][nH]c2c1 |
| InChI | InChI=1S/C18H25N.C6H6N2/c1-12-11-16(19)14(3)17(13(12)2)18(4,5)15-9-7-6-8-10-15;1-2-4-6-5(3-1)7-8-6/h7,9-11H,6,8,19H2,1-5H3;1-4,7-8H |
| InChIKey | YUDBSUNLLFAHSO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|