C22H23N5OS — CID 143613878
2-[4-(2,5-dihydro-1H-pyrrol-3-yl)-1,2,4-triazol-3-yl]-4-methyl-N-(4-propan-2-yloxycyclohexa-1,2,3,5-tetraen-1-yl)sulfanylaniline (PubChem CID 143613878) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is 2-[4-(2,5-dihydro-1H-pyrrol-3-yl)-1,2,4-triazol-3-yl]-4-methyl-N-(4-propan-2-yloxycyclohexa-1,2,3,5-tetraen-1-yl)sulfanylaniline.
| Compound Name | 2-[4-(2,5-dihydro-1H-pyrrol-3-yl)-1,2,4-triazol-3-yl]-4-methyl-N-(4-propan-2-yloxycyclohexa-1,2,3,5-tetraen-1-yl)sulfanylaniline |
|---|---|
| PubChem CID | 143613878 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[4-(2,5-dihydro-1H-pyrrol-3-yl)-1,2,4-triazol-3-yl]-4-methyl-N-(4-propan-2-yloxycyclohexa-1,2,3,5-tetraen-1-yl)sulfanylaniline |
| SMILES | Cc1ccc(NSC2=C=C=C(OC(C)C)C=C2)c(-c2nncn2C2=CCNC2)c1 |
| InChI | InChI=1S/C22H23N5OS/c1-15(2)28-18-5-7-19(8-6-18)29-26-21-9-4-16(3)12-20(21)22-25-24-14-27(22)17-10-11-23-13-17/h4-5,7,9-10,12,14-15,23,26H,11,13H2,1-3H3 |
| InChIKey | RGSQZLCZPNJUHE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|