C12H19N — CID 143614014
1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methylpyrrolidine (PubChem CID 143614014) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methylpyrrolidine.
| Compound Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 143614014 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methylpyrrolidine |
| SMILES | C=C/C=C\C(=C/C)N1CCC(C)C1 |
| InChI | InChI=1S/C12H19N/c1-4-6-7-12(5-2)13-9-8-11(3)10-13/h4-7,11H,1,8-10H2,2-3H3/b7-6-,12-5+ |
| InChIKey | UUSRRTNQRDIFJA-BZNMCICSSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|