C19H22N4S — CID 143614249
3-[(2E,4Z,6Z)-4-methylnona-2,4,6-trienimidoyl]-5-phenyl-6H-1,3,4-thiadiazin-2-imine (PubChem CID 143614249) has the molecular formula C19H22N4S and a molecular weight of 338.48 g/mol. Its IUPAC name is 3-[(2E,4Z,6Z)-4-methylnona-2,4,6-trienimidoyl]-5-phenyl-6H-1,3,4-thiadiazin-2-imine.
| Compound Name | 3-[(2E,4Z,6Z)-4-methylnona-2,4,6-trienimidoyl]-5-phenyl-6H-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 143614249 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-[(2E,4Z,6Z)-4-methylnona-2,4,6-trienimidoyl]-5-phenyl-6H-1,3,4-thiadiazin-2-imine |
| SMILES | [H]/N=C1\SCC(c2ccccc2)=NN1C(/C=C/C(C)=C\C=C/CC)=N/[H] |
| InChI | InChI=1S/C19H22N4S/c1-3-4-6-9-15(2)12-13-18(20)23-19(21)24-14-17(22-23)16-10-7-5-8-11-16/h4-13,20-21H,3,14H2,1-2H3/b6-4-,13-12+,15-9-,20-18+,21-19- |
| InChIKey | AIKCFOMMLHKWLM-VUUGQJKQSA-N |
| XLogP | 4.82 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|