C13H31N3 — CID 143614353
N,N',N'-trimethylethane-1,2-diamine;N,N,4-trimethylpent-1-en-3-amine (PubChem CID 143614353) has the molecular formula C13H31N3 and a molecular weight of 229.41 g/mol. Its IUPAC name is N,N',N'-trimethylethane-1,2-diamine;N,N,4-trimethylpent-1-en-3-amine.
| Compound Name | N,N',N'-trimethylethane-1,2-diamine;N,N,4-trimethylpent-1-en-3-amine |
|---|---|
| PubChem CID | 143614353 |
| Molecular Formula | C13H31N3 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.25 |
| IUPAC Name | N,N',N'-trimethylethane-1,2-diamine;N,N,4-trimethylpent-1-en-3-amine |
| SMILES | C=CC(C(C)C)N(C)C.CNCCN(C)C |
| InChI | InChI=1S/C8H17N.C5H14N2/c1-6-8(7(2)3)9(4)5;1-6-4-5-7(2)3/h6-8H,1H2,2-5H3;6H,4-5H2,1-3H3 |
| InChIKey | HRYGFNMVFGNAEX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|