About (4-ethylcyclohexa-1,5-dien-1-yl)benzene
(4-ethylcyclohexa-1,5-dien-1-yl)benzene (PubChem CID 143614396) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is (4-ethylcyclohexa-1,5-dien-1-yl)benzene.
Molecular Properties
| Compound Name | (4-ethylcyclohexa-1,5-dien-1-yl)benzene |
| PubChem CID | 143614396 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (4-ethylcyclohexa-1,5-dien-1-yl)benzene |
| SMILES | CCC1C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C14H16/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h3-8,10-12H,2,9H2,1H3 |
| InChIKey | ISUNBPBGUVJKOE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4-ethylcyclohexa-1,5-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylcyclohexa-1,5-dien-1-yl)benzene?
The IUPAC name of (4-ethylcyclohexa-1,5-dien-1-yl)benzene (CID 143614396) is (4-ethylcyclohexa-1,5-dien-1-yl)benzene.
What is the SMILES notation for (4-ethylcyclohexa-1,5-dien-1-yl)benzene?
The canonical SMILES for (4-ethylcyclohexa-1,5-dien-1-yl)benzene is CCC1C=CC(c2ccccc2)=CC1.
What is the InChIKey of (4-ethylcyclohexa-1,5-dien-1-yl)benzene?
The InChIKey is ISUNBPBGUVJKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h3-8,10-12H,2,9H2,1H3.
What are the key properties of (4-ethylcyclohexa-1,5-dien-1-yl)benzene?
(4-ethylcyclohexa-1,5-dien-1-yl)benzene has a molecular weight of 184.28 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylcyclohexa-1,5-dien-1-yl)benzene is sourced from PubChem (CID 143614396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).