About ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol
ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol (PubChem CID 143615644) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol.
Molecular Properties
| Compound Name | ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol |
| PubChem CID | 143615644 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol |
| SMILES | CC/C=C\C(=C/CC)[C@@H](O)CCNCC.CCO |
| InChI | InChI=1S/C13H25NO.C2H6O/c1-4-7-9-12(8-5-2)13(15)10-11-14-6-3;1-2-3/h7-9,13-15H,4-6,10-11H2,1-3H3;3H,2H2,1H3/b9-7-,12-8+;/t13-;/m0./s1 |
| InChIKey | SLQIQBCBAHFHFL-FMJCUNFYSA-N |
| XLogP | 2.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol?
The IUPAC name of ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol (CID 143615644) is ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol.
What is the SMILES notation for ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol?
The canonical SMILES for ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol is CC/C=C\C(=C/CC)[C@@H](O)CCNCC.CCO.
What is the InChIKey of ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol?
The InChIKey is SLQIQBCBAHFHFL-FMJCUNFYSA-N. The full InChI is InChI=1S/C13H25NO.C2H6O/c1-4-7-9-12(8-5-2)13(15)10-11-14-6-3;1-2-3/h7-9,13-15H,4-6,10-11H2,1-3H3;3H,2H2,1H3/b9-7-,12-8+;/t13-;/m0./s1.
What are the key properties of ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol?
ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol has a molecular weight of 257.42 g/mol, XLogP of 2.65, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;(Z,3S,4E)-1-(ethylamino)-4-propylideneoct-5-en-3-ol is sourced from PubChem (CID 143615644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).