C7H9N2P — CID 143615652
5-ethynyl-1-phosphanylpyrrolidine-2-carbonitrile (PubChem CID 143615652) has the molecular formula C7H9N2P and a molecular weight of 152.14 g/mol. Its IUPAC name is 5-ethynyl-1-phosphanylpyrrolidine-2-carbonitrile.
| Compound Name | 5-ethynyl-1-phosphanylpyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 143615652 |
| Molecular Formula | C7H9N2P |
| Molecular Weight | 152.14 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 5-ethynyl-1-phosphanylpyrrolidine-2-carbonitrile |
| SMILES | C#CC1CCC(C#N)N1P |
| InChI | InChI=1S/C7H9N2P/c1-2-6-3-4-7(5-8)9(6)10/h1,6-7H,3-4,10H2 |
| InChIKey | SHUMBSMXNKCGAB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.14 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|