About 4-bromo-5-methyl-1,2-oxazole
4-bromo-5-methyl-1,2-oxazole (PubChem CID 14361578) has the molecular formula C4H4BrNO
and a molecular weight of 161.99 g/mol. Its IUPAC name is 4-bromo-5-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-bromo-5-methyl-1,2-oxazole |
| PubChem CID | 14361578 |
| Molecular Formula | C4H4BrNO |
| Molecular Weight | 161.99 g/mol |
| Exact Mass | 160.95 |
| IUPAC Name | 4-bromo-5-methyl-1,2-oxazole |
| SMILES | Cc1oncc1Br |
| InChI | InChI=1S/C4H4BrNO/c1-3-4(5)2-6-7-3/h2H,1H3 |
| InChIKey | SBDZMDRGAWHCNX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.99 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-5-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-methyl-1,2-oxazole?
The IUPAC name of 4-bromo-5-methyl-1,2-oxazole (CID 14361578) is 4-bromo-5-methyl-1,2-oxazole.
What is the SMILES notation for 4-bromo-5-methyl-1,2-oxazole?
The canonical SMILES for 4-bromo-5-methyl-1,2-oxazole is Cc1oncc1Br.
What is the InChIKey of 4-bromo-5-methyl-1,2-oxazole?
The InChIKey is SBDZMDRGAWHCNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrNO/c1-3-4(5)2-6-7-3/h2H,1H3.
What are the key properties of 4-bromo-5-methyl-1,2-oxazole?
4-bromo-5-methyl-1,2-oxazole has a molecular weight of 161.99 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-methyl-1,2-oxazole is sourced from PubChem (CID 14361578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).