C32H36Cl2N4O4 — CID 143616013
6,7-dichloro-4-ethyl-1,4-benzoxazin-3-one;N-[4-[3-[1-[formyl(methyl)amino]-2-pyrrolidin-1-ylethyl]phenyl]phenyl]acetamide (PubChem CID 143616013) has the molecular formula C32H36Cl2N4O4 and a molecular weight of 611.57 g/mol. Its IUPAC name is 6,7-dichloro-4-ethyl-1,4-benzoxazin-3-one;N-[4-[3-[1-[formyl(methyl)amino]-2-pyrrolidin-1-ylethyl]phenyl]phenyl]acetamide.
| Compound Name | 6,7-dichloro-4-ethyl-1,4-benzoxazin-3-one;N-[4-[3-[1-[formyl(methyl)amino]-2-pyrrolidin-1-ylethyl]phenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 143616013 |
| Molecular Formula | C32H36Cl2N4O4 |
| Molecular Weight | 611.57 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | 6,7-dichloro-4-ethyl-1,4-benzoxazin-3-one;N-[4-[3-[1-[formyl(methyl)amino]-2-pyrrolidin-1-ylethyl]phenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cccc(C(CN3CCCC3)N(C)C=O)c2)cc1.CCN1C(=O)COc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C22H27N3O2.C10H9Cl2NO2/c1-17(27)23-21-10-8-18(9-11-21)19-6-5-7-20(14-19)22(24(2)16-26)15-25-12-3-4-13-25;1-2-13-8-3-6(11)7(12)4-9(8)15-5-10(13)14/h5-11,14,16,22H,3-4,12-13,15H2,1-2H3,(H,23,27);3-4H,2,5H2,1H3 |
| InChIKey | XOVOVUFSTJWIEA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|