C21H28ClN3OS — CID 143616634
2-(3-chloro-4-methylsulfanylphenyl)-3-cyclopentyl-N-(1-propylpyrazol-3-yl)propanamide (PubChem CID 143616634) has the molecular formula C21H28ClN3OS and a molecular weight of 406.00 g/mol. Its IUPAC name is 2-(3-chloro-4-methylsulfanylphenyl)-3-cyclopentyl-N-(1-propylpyrazol-3-yl)propanamide.
| Compound Name | 2-(3-chloro-4-methylsulfanylphenyl)-3-cyclopentyl-N-(1-propylpyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 143616634 |
| Molecular Formula | C21H28ClN3OS |
| Molecular Weight | 406.00 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-(3-chloro-4-methylsulfanylphenyl)-3-cyclopentyl-N-(1-propylpyrazol-3-yl)propanamide |
| SMILES | CCCn1ccc(NC(=O)C(CC2CCCC2)c2ccc(SC)c(Cl)c2)n1 |
| InChI | InChI=1S/C21H28ClN3OS/c1-3-11-25-12-10-20(24-25)23-21(26)17(13-15-6-4-5-7-15)16-8-9-19(27-2)18(22)14-16/h8-10,12,14-15,17H,3-7,11,13H2,1-2H3,(H,23,24,26) |
| InChIKey | FCWCZEKEWJGWKR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.00 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |