C8H18ClN — CID 143616689
(2S,3R)-3-chloro-N,N,2-trimethylpentan-1-amine (PubChem CID 143616689) has the molecular formula C8H18ClN and a molecular weight of 163.69 g/mol. Its IUPAC name is (2S,3R)-3-chloro-N,N,2-trimethylpentan-1-amine.
| Compound Name | (2S,3R)-3-chloro-N,N,2-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 143616689 |
| Molecular Formula | C8H18ClN |
| Molecular Weight | 163.69 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (2S,3R)-3-chloro-N,N,2-trimethylpentan-1-amine |
| SMILES | CC[C@@H](Cl)[C@@H](C)CN(C)C |
| InChI | InChI=1S/C8H18ClN/c1-5-8(9)7(2)6-10(3)4/h7-8H,5-6H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | BKABIBFULYJILP-JGVFFNPUSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|