C19H26N4O2 — CID 143616734
N-(4-amino-3-hydroxy-2-methylphenyl)hexanamide;cyclohexa-3,5-diene-1,2-diimine (PubChem CID 143616734) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(4-amino-3-hydroxy-2-methylphenyl)hexanamide;cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | N-(4-amino-3-hydroxy-2-methylphenyl)hexanamide;cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 143616734 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-(4-amino-3-hydroxy-2-methylphenyl)hexanamide;cyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCCCCC(=O)Nc1ccc(N)c(O)c1C.[H]/N=C1\C=CC=C\C1=N/[H] |
| InChI | InChI=1S/C13H20N2O2.C6H6N2/c1-3-4-5-6-12(16)15-11-8-7-10(14)13(17)9(11)2;7-5-3-1-2-4-6(5)8/h7-8,17H,3-6,14H2,1-2H3,(H,15,16);1-4,7-8H/b;7-5+,8-6+ |
| InChIKey | NLFWQPWTQSKBRZ-JTEAZJOVSA-N |
| XLogP | 3.95 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|