About (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine
(Z)-2-N-ethenylhept-4-ene-2,3,6-triimine (PubChem CID 143616909) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine.
Molecular Properties
| Compound Name | (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine |
| PubChem CID | 143616909 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine |
| SMILES | [H]/N=C(/C=C\C(C)=N\[H])C(\C)=N\C=C |
| InChI | InChI=1S/C9H13N3/c1-4-12-8(3)9(11)6-5-7(2)10/h4-6,10-11H,1H2,2-3H3/b6-5-,10-7+,11-9-,12-8+ |
| InChIKey | HKMPZIKAUREWCK-SDTDOALFSA-N |
| XLogP | 2.21 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine?
The IUPAC name of (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine (CID 143616909) is (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine.
What is the SMILES notation for (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine?
The canonical SMILES for (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine is [H]/N=C(/C=C\C(C)=N\[H])C(\C)=N\C=C.
What is the InChIKey of (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine?
The InChIKey is HKMPZIKAUREWCK-SDTDOALFSA-N. The full InChI is InChI=1S/C9H13N3/c1-4-12-8(3)9(11)6-5-7(2)10/h4-6,10-11H,1H2,2-3H3/b6-5-,10-7+,11-9-,12-8+.
What are the key properties of (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine?
(Z)-2-N-ethenylhept-4-ene-2,3,6-triimine has a molecular weight of 163.22 g/mol, XLogP of 2.21, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-N-ethenylhept-4-ene-2,3,6-triimine is sourced from PubChem (CID 143616909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).