C13H32N2 — CID 143617011
ethane;1-methyl-2,3,6,7-tetrahydroazepin-3-amine (PubChem CID 143617011) has the molecular formula C13H32N2 and a molecular weight of 216.41 g/mol. Its IUPAC name is ethane;1-methyl-2,3,6,7-tetrahydroazepin-3-amine.
| Compound Name | ethane;1-methyl-2,3,6,7-tetrahydroazepin-3-amine |
|---|---|
| PubChem CID | 143617011 |
| Molecular Formula | C13H32N2 |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.26 |
| IUPAC Name | ethane;1-methyl-2,3,6,7-tetrahydroazepin-3-amine |
| SMILES | CC.CC.CC.CN1CCC=CC(N)C1 |
| InChI | InChI=1S/C7H14N2.3C2H6/c1-9-5-3-2-4-7(8)6-9;3*1-2/h2,4,7H,3,5-6,8H2,1H3;3*1-2H3 |
| InChIKey | WBMBDGMJZHBFRY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|