About [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol
[(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol (PubChem CID 143618087) has the molecular formula C11H15ClNOP
and a molecular weight of 243.67 g/mol. Its IUPAC name is [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol |
| PubChem CID | 143618087 |
| Molecular Formula | C11H15ClNOP |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol |
| SMILES | NC[C@@]1(c2ccc(Cl)c(P)c2)C[C@H]1CO |
| InChI | InChI=1S/C11H15ClNOP/c12-9-2-1-7(3-10(9)15)11(6-13)4-8(11)5-14/h1-3,8,14H,4-6,13,15H2/t8-,11+/m0/s1 |
| InChIKey | HJTUDBKONGSUCF-GZMMTYOYSA-N |
| XLogP | 1.05 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol?
The IUPAC name of [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol (CID 143618087) is [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol.
What is the SMILES notation for [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol?
The canonical SMILES for [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol is NC[C@@]1(c2ccc(Cl)c(P)c2)C[C@H]1CO.
What is the InChIKey of [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol?
The InChIKey is HJTUDBKONGSUCF-GZMMTYOYSA-N. The full InChI is InChI=1S/C11H15ClNOP/c12-9-2-1-7(3-10(9)15)11(6-13)4-8(11)5-14/h1-3,8,14H,4-6,13,15H2/t8-,11+/m0/s1.
What are the key properties of [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol?
[(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol has a molecular weight of 243.67 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-(aminomethyl)-2-(4-chloro-3-phosphanylphenyl)cyclopropyl]methanol is sourced from PubChem (CID 143618087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).