C23H26O6 — CID 143618518
(1R,3R,5S,18R)-3-(1-methoxyethenyl)-1,5,18-trimethyl-13,17-dioxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-12(19),14-diene-6,11,16-trione (PubChem CID 143618518) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is (1R,3R,5S,18R)-3-(1-methoxyethenyl)-1,5,18-trimethyl-13,17-dioxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-12(19),14-diene-6,11,16-trione.
| Compound Name | (1R,3R,5S,18R)-3-(1-methoxyethenyl)-1,5,18-trimethyl-13,17-dioxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-12(19),14-diene-6,11,16-trione |
|---|---|
| PubChem CID | 143618518 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (1R,3R,5S,18R)-3-(1-methoxyethenyl)-1,5,18-trimethyl-13,17-dioxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-12(19),14-diene-6,11,16-trione |
| SMILES | C=C(OC)C1C[C@]2(C)C(=O)CCC2C2C(=O)c3occ4c3[C@@](C)(C12)[C@@H](C)OC4=O |
| InChI | InChI=1S/C23H26O6/c1-10(27-5)12-8-22(3)14(6-7-15(22)24)16-17(12)23(4)11(2)29-21(26)13-9-28-20(18(13)23)19(16)25/h9,11-12,14,16-17H,1,6-8H2,2-5H3/t11-,12?,14?,16?,17?,22+,23-/m1/s1 |
| InChIKey | ZFBGVDKVKIKWDG-RUQRSCMSSA-N |
| XLogP | 3.69 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|