About [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol
[4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol (PubChem CID 143618659) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol |
| PubChem CID | 143618659 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol |
| SMILES | C=C/C=C(\C=C)C1(CO)CCNCC1 |
| InChI | InChI=1S/C12H19NO/c1-3-5-11(4-2)12(10-14)6-8-13-9-7-12/h3-5,13-14H,1-2,6-10H2/b11-5+ |
| InChIKey | OGZFYRVXIUAZBK-VZUCSPMQSA-N |
| XLogP | 1.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol?
The IUPAC name of [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol (CID 143618659) is [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol.
What is the SMILES notation for [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol?
The canonical SMILES for [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol is C=C/C=C(\C=C)C1(CO)CCNCC1.
What is the InChIKey of [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol?
The InChIKey is OGZFYRVXIUAZBK-VZUCSPMQSA-N. The full InChI is InChI=1S/C12H19NO/c1-3-5-11(4-2)12(10-14)6-8-13-9-7-12/h3-5,13-14H,1-2,6-10H2/b11-5+.
What are the key properties of [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol?
[4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol has a molecular weight of 193.29 g/mol, XLogP of 1.65, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3E)-hexa-1,3,5-trien-3-yl]piperidin-4-yl]methanol is sourced from PubChem (CID 143618659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).