About (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine
(Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine (PubChem CID 143618673) has the molecular formula C16H16N4
and a molecular weight of 264.33 g/mol. Its IUPAC name is (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine.
Molecular Properties
| Compound Name | (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine |
| PubChem CID | 143618673 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine |
| SMILES | Cc1ccc2c(c1)c(/C(N)=C/c1cnccn1)cn2C |
| InChI | InChI=1S/C16H16N4/c1-11-3-4-16-13(7-11)14(10-20(16)2)15(17)8-12-9-18-5-6-19-12/h3-10H,17H2,1-2H3/b15-8- |
| InChIKey | CFTALBRAOUEVDO-NVNXTCNLSA-N |
| XLogP | 2.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine?
The IUPAC name of (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine (CID 143618673) is (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine.
What is the SMILES notation for (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine?
The canonical SMILES for (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine is Cc1ccc2c(c1)c(/C(N)=C/c1cnccn1)cn2C.
What is the InChIKey of (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine?
The InChIKey is CFTALBRAOUEVDO-NVNXTCNLSA-N. The full InChI is InChI=1S/C16H16N4/c1-11-3-4-16-13(7-11)14(10-20(16)2)15(17)8-12-9-18-5-6-19-12/h3-10H,17H2,1-2H3/b15-8-.
What are the key properties of (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine?
(Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine has a molecular weight of 264.33 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(1,5-dimethylindol-3-yl)-2-pyrazin-2-ylethenamine is sourced from PubChem (CID 143618673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).