About 1,4-dioxaspiro[4.5]decane;phenylmethanamine
1,4-dioxaspiro[4.5]decane;phenylmethanamine (PubChem CID 143618966) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decane;phenylmethanamine.
Molecular Properties
| Compound Name | 1,4-dioxaspiro[4.5]decane;phenylmethanamine |
| PubChem CID | 143618966 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decane;phenylmethanamine |
| SMILES | C1CCC2(CC1)OCCO2.NCc1ccccc1 |
| InChI | InChI=1S/C8H14O2.C7H9N/c1-2-4-8(5-3-1)9-6-7-10-8;8-6-7-4-2-1-3-5-7/h1-7H2;1-5H,6,8H2 |
| InChIKey | CJNBQLADWVBZSV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dioxaspiro[4.5]decane;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxaspiro[4.5]decane;phenylmethanamine?
The IUPAC name of 1,4-dioxaspiro[4.5]decane;phenylmethanamine (CID 143618966) is 1,4-dioxaspiro[4.5]decane;phenylmethanamine.
What is the SMILES notation for 1,4-dioxaspiro[4.5]decane;phenylmethanamine?
The canonical SMILES for 1,4-dioxaspiro[4.5]decane;phenylmethanamine is C1CCC2(CC1)OCCO2.NCc1ccccc1.
What is the InChIKey of 1,4-dioxaspiro[4.5]decane;phenylmethanamine?
The InChIKey is CJNBQLADWVBZSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C7H9N/c1-2-4-8(5-3-1)9-6-7-10-8;8-6-7-4-2-1-3-5-7/h1-7H2;1-5H,6,8H2.
What are the key properties of 1,4-dioxaspiro[4.5]decane;phenylmethanamine?
1,4-dioxaspiro[4.5]decane;phenylmethanamine has a molecular weight of 249.35 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxaspiro[4.5]decane;phenylmethanamine is sourced from PubChem (CID 143618966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).