C51H41N3 — CID 143619851
N-[(1Z,3Z)-1-[3-carbazol-9-yl-5-(8H-cyclohepta[b]indol-5-yl)phenyl]-3-phenylhexa-1,3-dienyl]-1-phenylethanimine (PubChem CID 143619851) has the molecular formula C51H41N3 and a molecular weight of 695.91 g/mol. Its IUPAC name is N-[(1Z,3Z)-1-[3-carbazol-9-yl-5-(8H-cyclohepta[b]indol-5-yl)phenyl]-3-phenylhexa-1,3-dienyl]-1-phenylethanimine.
| Compound Name | N-[(1Z,3Z)-1-[3-carbazol-9-yl-5-(8H-cyclohepta[b]indol-5-yl)phenyl]-3-phenylhexa-1,3-dienyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 143619851 |
| Molecular Formula | C51H41N3 |
| Molecular Weight | 695.91 g/mol |
| Exact Mass | 695.33 |
| IUPAC Name | N-[(1Z,3Z)-1-[3-carbazol-9-yl-5-(8H-cyclohepta[b]indol-5-yl)phenyl]-3-phenylhexa-1,3-dienyl]-1-phenylethanimine |
| SMILES | CC/C=C(/C=C(\N=C(/C)c1ccccc1)c1cc(-n2c3c(c4ccccc42)C=CCC=C3)cc(-n2c3ccccc3c3ccccc32)c1)c1ccccc1 |
| InChI | InChI=1S/C51H41N3/c1-3-19-39(38-22-9-5-10-23-38)34-47(52-36(2)37-20-7-4-8-21-37)40-32-41(53-48-28-12-6-11-24-43(48)44-25-13-16-29-49(44)53)35-42(33-40)54-50-30-17-14-26-45(50)46-27-15-18-31-51(46)54/h4-5,7-35H,3,6H2,1-2H3/b39-19-,47-34-,52-36+ |
| InChIKey | BQWQPPURZGWEKX-MADXFOJKSA-N |
| XLogP | 13.50 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.91 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|