C15H23NO3 — CID 143619926
(2Z,4Z)-3-(dimethylamino)-2-[(3E)-3-hydroxyhexa-1,3-dien-2-yl]hepta-2,4-dienoic acid (PubChem CID 143619926) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (2Z,4Z)-3-(dimethylamino)-2-[(3E)-3-hydroxyhexa-1,3-dien-2-yl]hepta-2,4-dienoic acid.
| Compound Name | (2Z,4Z)-3-(dimethylamino)-2-[(3E)-3-hydroxyhexa-1,3-dien-2-yl]hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 143619926 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (2Z,4Z)-3-(dimethylamino)-2-[(3E)-3-hydroxyhexa-1,3-dien-2-yl]hepta-2,4-dienoic acid |
| SMILES | C=C(/C(C(=O)O)=C(\C=C/CC)N(C)C)/C(O)=C\CC |
| InChI | InChI=1S/C15H23NO3/c1-6-8-10-12(16(4)5)14(15(18)19)11(3)13(17)9-7-2/h8-10,17H,3,6-7H2,1-2,4-5H3,(H,18,19)/b10-8-,13-9+,14-12- |
| InChIKey | OSDVECBBFIXQDA-WGPNRIAESA-N |
| XLogP | 3.26 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|