About 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile
6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile (PubChem CID 143620219) has the molecular formula C21H23ClN4O
and a molecular weight of 382.90 g/mol. Its IUPAC name is 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile.
Molecular Properties
| Compound Name | 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile |
| PubChem CID | 143620219 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile |
| SMILES | CC(C)(CCC#N)c1ccc(C=O)cc1.CNc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C13H15NO.C8H8ClN3/c1-13(2,8-3-9-14)12-6-4-11(10-15)5-7-12;1-10-7-5-12-4-6(9)2-3-8(12)11-7/h4-7,10H,3,8H2,1-2H3;2-5,10H,1H3 |
| InChIKey | YNFCARULKPDHTO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile?
The IUPAC name of 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile (CID 143620219) is 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile.
What is the SMILES notation for 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile?
The canonical SMILES for 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile is CC(C)(CCC#N)c1ccc(C=O)cc1.CNc1cn2cc(Cl)ccc2n1.
What is the InChIKey of 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile?
The InChIKey is YNFCARULKPDHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO.C8H8ClN3/c1-13(2,8-3-9-14)12-6-4-11(10-15)5-7-12;1-10-7-5-12-4-6(9)2-3-8(12)11-7/h4-7,10H,3,8H2,1-2H3;2-5,10H,1H3.
What are the key properties of 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile?
6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile has a molecular weight of 382.90 g/mol, XLogP of 5.11, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-methylimidazo[1,2-a]pyridin-2-amine;4-(4-formylphenyl)-4-methylpentanenitrile is sourced from PubChem (CID 143620219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).