C25H20N5O3PS — CID 143620257
3-methyl-N-[6-[3-[(3-phosphanylbenzoyl)amino]phenoxy]imidazo[1,2-b]pyridazin-2-yl]thiophene-2-carboxamide (PubChem CID 143620257) has the molecular formula C25H20N5O3PS and a molecular weight of 501.51 g/mol. Its IUPAC name is 3-methyl-N-[6-[3-[(3-phosphanylbenzoyl)amino]phenoxy]imidazo[1,2-b]pyridazin-2-yl]thiophene-2-carboxamide.
| Compound Name | 3-methyl-N-[6-[3-[(3-phosphanylbenzoyl)amino]phenoxy]imidazo[1,2-b]pyridazin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143620257 |
| Molecular Formula | C25H20N5O3PS |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 3-methyl-N-[6-[3-[(3-phosphanylbenzoyl)amino]phenoxy]imidazo[1,2-b]pyridazin-2-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1cn2nc(Oc3cccc(NC(=O)c4cccc(P)c4)c3)ccc2n1 |
| InChI | InChI=1S/C25H20N5O3PS/c1-15-10-11-35-23(15)25(32)28-20-14-30-21(27-20)8-9-22(29-30)33-18-6-3-5-17(13-18)26-24(31)16-4-2-7-19(34)12-16/h2-14H,34H2,1H3,(H,26,31)(H,28,32) |
| InChIKey | XNGOPYWASFEHED-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|