About cyclopropyl(1,2,4-triazol-1-yl)methanone
cyclopropyl(1,2,4-triazol-1-yl)methanone (PubChem CID 14362058) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is cyclopropyl(1,2,4-triazol-1-yl)methanone.
Molecular Properties
| Compound Name | cyclopropyl(1,2,4-triazol-1-yl)methanone |
| PubChem CID | 14362058 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | cyclopropyl(1,2,4-triazol-1-yl)methanone |
| SMILES | O=C(C1CC1)n1cncn1 |
| InChI | InChI=1S/C6H7N3O/c10-6(5-1-2-5)9-4-7-3-8-9/h3-5H,1-2H2 |
| InChIKey | YGSIVQOXOMZTQW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopropyl(1,2,4-triazol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl(1,2,4-triazol-1-yl)methanone?
The IUPAC name of cyclopropyl(1,2,4-triazol-1-yl)methanone (CID 14362058) is cyclopropyl(1,2,4-triazol-1-yl)methanone.
What is the SMILES notation for cyclopropyl(1,2,4-triazol-1-yl)methanone?
The canonical SMILES for cyclopropyl(1,2,4-triazol-1-yl)methanone is O=C(C1CC1)n1cncn1.
What is the InChIKey of cyclopropyl(1,2,4-triazol-1-yl)methanone?
The InChIKey is YGSIVQOXOMZTQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c10-6(5-1-2-5)9-4-7-3-8-9/h3-5H,1-2H2.
What are the key properties of cyclopropyl(1,2,4-triazol-1-yl)methanone?
cyclopropyl(1,2,4-triazol-1-yl)methanone has a molecular weight of 137.14 g/mol, XLogP of 0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl(1,2,4-triazol-1-yl)methanone is sourced from PubChem (CID 14362058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).