C10H11BrN4S — CID 143620727
1-(4-bromo-1H-benzimidazol-2-yl)-1-(imino-λ4-sulfanylidene)-N,N-dimethylmethanamine (PubChem CID 143620727) has the molecular formula C10H11BrN4S and a molecular weight of 299.20 g/mol. Its IUPAC name is 1-(4-bromo-1H-benzimidazol-2-yl)-1-(imino-λ4-sulfanylidene)-N,N-dimethylmethanamine.
| Compound Name | 1-(4-bromo-1H-benzimidazol-2-yl)-1-(imino-λ4-sulfanylidene)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 143620727 |
| Molecular Formula | C10H11BrN4S |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 1-(4-bromo-1H-benzimidazol-2-yl)-1-(imino-λ4-sulfanylidene)-N,N-dimethylmethanamine |
| SMILES | CN(C)C(=S=N)c1nc2c(Br)cccc2[nH]1 |
| InChI | InChI=1S/C10H11BrN4S/c1-15(2)10(16-12)9-13-7-5-3-4-6(11)8(7)14-9/h3-5,12H,1-2H3,(H,13,14) |
| InChIKey | KXIAJSRDTICKFU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|