C14H20FN — CID 143621189
(2Z,3Z,5Z)-4-fluoro-N,3,6-trimethyl-2-propylideneocta-3,5,7-trien-1-imine (PubChem CID 143621189) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is (2Z,3Z,5Z)-4-fluoro-N,3,6-trimethyl-2-propylideneocta-3,5,7-trien-1-imine.
| Compound Name | (2Z,3Z,5Z)-4-fluoro-N,3,6-trimethyl-2-propylideneocta-3,5,7-trien-1-imine |
|---|---|
| PubChem CID | 143621189 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (2Z,3Z,5Z)-4-fluoro-N,3,6-trimethyl-2-propylideneocta-3,5,7-trien-1-imine |
| SMILES | C=C/C(C)=C\C(F)=C(C)\C(=C\CC)\C=N\C |
| InChI | InChI=1S/C14H20FN/c1-6-8-13(10-16-5)12(4)14(15)9-11(3)7-2/h7-10H,2,6H2,1,3-5H3/b11-9-,13-8+,14-12-,16-10+ |
| InChIKey | XMTOJBLWFGFVFR-CUYXHWTPSA-N |
| XLogP | 4.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|