C12H10Cl4N2O2S — CID 14362139
4-chloro-N-[2,2,2-trichloro-1-(1H-pyrrol-2-yl)ethyl]benzenesulfonamide (PubChem CID 14362139) has the molecular formula C12H10Cl4N2O2S and a molecular weight of 388.10 g/mol. Its IUPAC name is 4-chloro-N-[2,2,2-trichloro-1-(1H-pyrrol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2,2,2-trichloro-1-(1H-pyrrol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 14362139 |
| Molecular Formula | C12H10Cl4N2O2S |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.92 |
| IUPAC Name | 4-chloro-N-[2,2,2-trichloro-1-(1H-pyrrol-2-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC(c1ccc[nH]1)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10Cl4N2O2S/c13-8-3-5-9(6-4-8)21(19,20)18-11(12(14,15)16)10-2-1-7-17-10/h1-7,11,17-18H |
| InChIKey | VVIIACAJUYNBFE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|