About 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole
5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole (PubChem CID 143622116) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole.
Molecular Properties
| Compound Name | 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole |
| PubChem CID | 143622116 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole |
| SMILES | CC1C=CC=C(c2nn[nH]n2)C=C1 |
| InChI | InChI=1S/C9H10N4/c1-7-3-2-4-8(6-5-7)9-10-12-13-11-9/h2-7H,1H3,(H,10,11,12,13) |
| InChIKey | AJZWHPXGWHAEAX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole?
The IUPAC name of 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole (CID 143622116) is 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole.
What is the SMILES notation for 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole?
The canonical SMILES for 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole is CC1C=CC=C(c2nn[nH]n2)C=C1.
What is the InChIKey of 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole?
The InChIKey is AJZWHPXGWHAEAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-7-3-2-4-8(6-5-7)9-10-12-13-11-9/h2-7H,1H3,(H,10,11,12,13).
What are the key properties of 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole?
5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole has a molecular weight of 174.21 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methylcyclohepta-1,3,6-trien-1-yl)-2H-tetrazole is sourced from PubChem (CID 143622116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).