C25H27F6N3O2S — CID 143622489
2-amino-2-[2-[3-(trifluoromethyl)-4-[6-[4-(trifluoromethyl)phenyl]hexoxy]phenyl]-6H-1,3,4-thiadiazin-5-yl]ethanol (PubChem CID 143622489) has the molecular formula C25H27F6N3O2S and a molecular weight of 547.57 g/mol. Its IUPAC name is 2-amino-2-[2-[3-(trifluoromethyl)-4-[6-[4-(trifluoromethyl)phenyl]hexoxy]phenyl]-6H-1,3,4-thiadiazin-5-yl]ethanol.
| Compound Name | 2-amino-2-[2-[3-(trifluoromethyl)-4-[6-[4-(trifluoromethyl)phenyl]hexoxy]phenyl]-6H-1,3,4-thiadiazin-5-yl]ethanol |
|---|---|
| PubChem CID | 143622489 |
| Molecular Formula | C25H27F6N3O2S |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 2-amino-2-[2-[3-(trifluoromethyl)-4-[6-[4-(trifluoromethyl)phenyl]hexoxy]phenyl]-6H-1,3,4-thiadiazin-5-yl]ethanol |
| SMILES | NC(CO)C1=NN=C(c2ccc(OCCCCCCc3ccc(C(F)(F)F)cc3)c(C(F)(F)F)c2)SC1 |
| InChI | InChI=1S/C25H27F6N3O2S/c26-24(27,28)18-9-6-16(7-10-18)5-3-1-2-4-12-36-22-11-8-17(13-19(22)25(29,30)31)23-34-33-21(15-37-23)20(32)14-35/h6-11,13,20,35H,1-5,12,14-15,32H2 |
| InChIKey | YWMXHOQHJWUTMF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|