About 1-pyrazin-2-ylethane-1,2-diol
1-pyrazin-2-ylethane-1,2-diol (PubChem CID 14362260) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 1-pyrazin-2-ylethane-1,2-diol.
Molecular Properties
| Compound Name | 1-pyrazin-2-ylethane-1,2-diol |
| PubChem CID | 14362260 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1-pyrazin-2-ylethane-1,2-diol |
| SMILES | OCC(O)c1cnccn1 |
| InChI | InChI=1S/C6H8N2O2/c9-4-6(10)5-3-7-1-2-8-5/h1-3,6,9-10H,4H2 |
| InChIKey | DSYZOEMHANKOOZ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrazin-2-ylethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazin-2-ylethane-1,2-diol?
The IUPAC name of 1-pyrazin-2-ylethane-1,2-diol (CID 14362260) is 1-pyrazin-2-ylethane-1,2-diol.
What is the SMILES notation for 1-pyrazin-2-ylethane-1,2-diol?
The canonical SMILES for 1-pyrazin-2-ylethane-1,2-diol is OCC(O)c1cnccn1.
What is the InChIKey of 1-pyrazin-2-ylethane-1,2-diol?
The InChIKey is DSYZOEMHANKOOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c9-4-6(10)5-3-7-1-2-8-5/h1-3,6,9-10H,4H2.
What are the key properties of 1-pyrazin-2-ylethane-1,2-diol?
1-pyrazin-2-ylethane-1,2-diol has a molecular weight of 140.14 g/mol, XLogP of -0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazin-2-ylethane-1,2-diol is sourced from PubChem (CID 14362260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).