C20H40N2O — CID 143623246
1-[(Z,3E)-3-butan-2-ylidene-7-methoxyoct-5-en-2-yl]piperidin-4-amine;ethane (PubChem CID 143623246) has the molecular formula C20H40N2O and a molecular weight of 324.55 g/mol. Its IUPAC name is 1-[(Z,3E)-3-butan-2-ylidene-7-methoxyoct-5-en-2-yl]piperidin-4-amine;ethane.
| Compound Name | 1-[(Z,3E)-3-butan-2-ylidene-7-methoxyoct-5-en-2-yl]piperidin-4-amine;ethane |
|---|---|
| PubChem CID | 143623246 |
| Molecular Formula | C20H40N2O |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.31 |
| IUPAC Name | 1-[(Z,3E)-3-butan-2-ylidene-7-methoxyoct-5-en-2-yl]piperidin-4-amine;ethane |
| SMILES | CC.CC/C(C)=C(\C/C=C\C(C)OC)C(C)N1CCC(N)CC1 |
| InChI | InChI=1S/C18H34N2O.C2H6/c1-6-14(2)18(9-7-8-15(3)21-5)16(4)20-12-10-17(19)11-13-20;1-2/h7-8,15-17H,6,9-13,19H2,1-5H3;1-2H3/b8-7-,18-14+; |
| InChIKey | HHMMSHBDMLLKNT-WMJPICHMSA-N |
| XLogP | 4.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|