C18H32N2O — CID 143623302
2-[1-[(3E,5E)-6-methoxy-3,4,5-trimethylocta-3,5,7-trien-2-yl]pyrrolidin-3-yl]ethanamine (PubChem CID 143623302) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-[1-[(3E,5E)-6-methoxy-3,4,5-trimethylocta-3,5,7-trien-2-yl]pyrrolidin-3-yl]ethanamine.
| Compound Name | 2-[1-[(3E,5E)-6-methoxy-3,4,5-trimethylocta-3,5,7-trien-2-yl]pyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 143623302 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 2-[1-[(3E,5E)-6-methoxy-3,4,5-trimethylocta-3,5,7-trien-2-yl]pyrrolidin-3-yl]ethanamine |
| SMILES | C=C/C(OC)=C(C)\C(C)=C(/C)C(C)N1CCC(CCN)C1 |
| InChI | InChI=1S/C18H32N2O/c1-7-18(21-6)15(4)13(2)14(3)16(5)20-11-9-17(12-20)8-10-19/h7,16-17H,1,8-12,19H2,2-6H3/b14-13+,18-15+ |
| InChIKey | NRGYVEKHSWBBKH-UUVOMYAKSA-N |
| XLogP | 3.49 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|