About 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde
3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 143623319) has the molecular formula C8H6ClFO
and a molecular weight of 172.59 g/mol. Its IUPAC name is 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde |
| PubChem CID | 143623319 |
| Molecular Formula | C8H6ClFO |
| Molecular Weight | 172.59 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | O=CC1=CC(Cl)=CC(F)C=C1 |
| InChI | InChI=1S/C8H6ClFO/c9-7-3-6(5-11)1-2-8(10)4-7/h1-5,8H |
| InChIKey | UBEBTOHZIQGDCI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.59 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde?
The IUPAC name of 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde (CID 143623319) is 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde.
What is the SMILES notation for 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde?
The canonical SMILES for 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde is O=CC1=CC(Cl)=CC(F)C=C1.
What is the InChIKey of 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde?
The InChIKey is UBEBTOHZIQGDCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClFO/c9-7-3-6(5-11)1-2-8(10)4-7/h1-5,8H.
What are the key properties of 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde?
3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde has a molecular weight of 172.59 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-fluorocyclohepta-1,3,6-triene-1-carbaldehyde is sourced from PubChem (CID 143623319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).