About ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride
ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride (PubChem CID 143623536) has the molecular formula C19H30FN3O2S
and a molecular weight of 383.53 g/mol. Its IUPAC name is ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride.
Molecular Properties
| Compound Name | ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride |
| PubChem CID | 143623536 |
| Molecular Formula | C19H30FN3O2S |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride |
| SMILES | C=C.CCCC(CC)C(NC)C(=O)N1CCCC1c1nc(C(=O)F)cs1 |
| InChI | InChI=1S/C17H26FN3O2S.C2H4/c1-4-7-11(5-2)14(19-3)17(23)21-9-6-8-13(21)16-20-12(10-24-16)15(18)22;1-2/h10-11,13-14,19H,4-9H2,1-3H3;1-2H2 |
| InChIKey | OUCLWZRANODMFR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride?
The IUPAC name of ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride (CID 143623536) is ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride.
What is the SMILES notation for ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride?
The canonical SMILES for ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride is C=C.CCCC(CC)C(NC)C(=O)N1CCCC1c1nc(C(=O)F)cs1.
What is the InChIKey of ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride?
The InChIKey is OUCLWZRANODMFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26FN3O2S.C2H4/c1-4-7-11(5-2)14(19-3)17(23)21-9-6-8-13(21)16-20-12(10-24-16)15(18)22;1-2/h10-11,13-14,19H,4-9H2,1-3H3;1-2H2.
What are the key properties of ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride?
ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride has a molecular weight of 383.53 g/mol, XLogP of 4.13, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-[1-[3-ethyl-2-(methylamino)hexanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl fluoride is sourced from PubChem (CID 143623536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).