C24H32 — CID 143624502
4-tert-butyl-2-[(E)-2,3-dimethyl-1-phenylpent-3-en-2-yl]-1-methylbenzene (PubChem CID 143624502) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is 4-tert-butyl-2-[(E)-2,3-dimethyl-1-phenylpent-3-en-2-yl]-1-methylbenzene.
| Compound Name | 4-tert-butyl-2-[(E)-2,3-dimethyl-1-phenylpent-3-en-2-yl]-1-methylbenzene |
|---|---|
| PubChem CID | 143624502 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 4-tert-butyl-2-[(E)-2,3-dimethyl-1-phenylpent-3-en-2-yl]-1-methylbenzene |
| SMILES | C/C=C(\C)C(C)(Cc1ccccc1)c1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C24H32/c1-8-19(3)24(7,17-20-12-10-9-11-13-20)22-16-21(23(4,5)6)15-14-18(22)2/h8-16H,17H2,1-7H3/b19-8+ |
| InChIKey | TVXTYOAJCTYKLV-UFWORHAWSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|