C14H20N2O3 — CID 143625160
ethane;2-ethoxy-3-ethylbenzimidazole-4-carboxylic acid (PubChem CID 143625160) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is ethane;2-ethoxy-3-ethylbenzimidazole-4-carboxylic acid.
| Compound Name | ethane;2-ethoxy-3-ethylbenzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 143625160 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | ethane;2-ethoxy-3-ethylbenzimidazole-4-carboxylic acid |
| SMILES | CC.CCOc1nc2cccc(C(=O)O)c2n1CC |
| InChI | InChI=1S/C12H14N2O3.C2H6/c1-3-14-10-8(11(15)16)6-5-7-9(10)13-12(14)17-4-2;1-2/h5-7H,3-4H2,1-2H3,(H,15,16);1-2H3 |
| InChIKey | ZIBNXBUAMLPYBR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |