C13H21NS — CID 143625192
3,4-dimethyl-2-[(3E,5Z)-octa-3,5-dien-3-yl]-2H-1,3-thiazole (PubChem CID 143625192) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is 3,4-dimethyl-2-[(3E,5Z)-octa-3,5-dien-3-yl]-2H-1,3-thiazole.
| Compound Name | 3,4-dimethyl-2-[(3E,5Z)-octa-3,5-dien-3-yl]-2H-1,3-thiazole |
|---|---|
| PubChem CID | 143625192 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3,4-dimethyl-2-[(3E,5Z)-octa-3,5-dien-3-yl]-2H-1,3-thiazole |
| SMILES | CC/C=C\C=C(/CC)C1SC=C(C)N1C |
| InChI | InChI=1S/C13H21NS/c1-5-7-8-9-12(6-2)13-14(4)11(3)10-15-13/h7-10,13H,5-6H2,1-4H3/b8-7-,12-9+ |
| InChIKey | HMWNFVBDOTVKKC-HVTAIUIQSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|