C14H18N2S — CID 143625444
(3Z,5Z)-6-amino-6-(5-ethylthiophen-2-yl)-2,2-dimethylhexa-3,5-dienenitrile (PubChem CID 143625444) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is (3Z,5Z)-6-amino-6-(5-ethylthiophen-2-yl)-2,2-dimethylhexa-3,5-dienenitrile.
| Compound Name | (3Z,5Z)-6-amino-6-(5-ethylthiophen-2-yl)-2,2-dimethylhexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 143625444 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (3Z,5Z)-6-amino-6-(5-ethylthiophen-2-yl)-2,2-dimethylhexa-3,5-dienenitrile |
| SMILES | CCc1ccc(/C(N)=C/C=C\C(C)(C)C#N)s1 |
| InChI | InChI=1S/C14H18N2S/c1-4-11-7-8-13(17-11)12(16)6-5-9-14(2,3)10-15/h5-9H,4,16H2,1-3H3/b9-5-,12-6- |
| InChIKey | RLPSDMSGEZHXKN-QIRVBYKSSA-N |
| XLogP | 3.72 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|